C20H14N2O6S — CID 17296915
5-[[4-(thiophene-2-carbonylamino)benzoyl]amino]benzene-1,3-dicarboxylic acid (PubChem CID 17296915) has the molecular formula C20H14N2O6S and a molecular weight of 410.41 g/mol. Its IUPAC name is 5-[[4-(thiophene-2-carbonylamino)benzoyl]amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[4-(thiophene-2-carbonylamino)benzoyl]amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 17296915 |
| Molecular Formula | C20H14N2O6S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 5-[[4-(thiophene-2-carbonylamino)benzoyl]amino]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(NC(=O)c2ccc(NC(=O)c3cccs3)cc2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C20H14N2O6S/c23-17(22-15-9-12(19(25)26)8-13(10-15)20(27)28)11-3-5-14(6-4-11)21-18(24)16-2-1-7-29-16/h1-10H,(H,21,24)(H,22,23)(H,25,26)(H,27,28) |
| InChIKey | RKYFUPUVXULQIA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |