C19H17N3O2S — CID 9480193
N-[4-[(N-methylanilino)carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 9480193) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is N-[4-[(N-methylanilino)carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[(N-methylanilino)carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9480193 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-[4-[(N-methylanilino)carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | CN(NC(=O)c1ccc(NC(=O)c2cccs2)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H17N3O2S/c1-22(16-6-3-2-4-7-16)21-18(23)14-9-11-15(12-10-14)20-19(24)17-8-5-13-25-17/h2-13H,1H3,(H,20,24)(H,21,23) |
| InChIKey | TYOUHLCYEUOJTR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|