C24H19N3O2S — CID 9154188
N-[4-[(2-anilinophenyl)carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 9154188) has the molecular formula C24H19N3O2S and a molecular weight of 413.50 g/mol. Its IUPAC name is N-[4-[(2-anilinophenyl)carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[(2-anilinophenyl)carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9154188 |
| Molecular Formula | C24H19N3O2S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | N-[4-[(2-anilinophenyl)carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1Nc1ccccc1)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C24H19N3O2S/c28-23(17-12-14-19(15-13-17)26-24(29)22-11-6-16-30-22)27-21-10-5-4-9-20(21)25-18-7-2-1-3-8-18/h1-16,25H,(H,26,29)(H,27,28) |
| InChIKey | MAQKRXLRMXKBNU-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |