C17H20N4O2S — CID 9205772
N-[4-[(4-methylpiperazin-1-yl)carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 9205772) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is N-[4-[(4-methylpiperazin-1-yl)carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[(4-methylpiperazin-1-yl)carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9205772 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-[4-[(4-methylpiperazin-1-yl)carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | CN1CCN(NC(=O)c2ccc(NC(=O)c3cccs3)cc2)CC1 |
| InChI | InChI=1S/C17H20N4O2S/c1-20-8-10-21(11-9-20)19-16(22)13-4-6-14(7-5-13)18-17(23)15-3-2-12-24-15/h2-7,12H,8-11H2,1H3,(H,18,23)(H,19,22) |
| InChIKey | XFEPWFRROUIEEN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |