C24H26N4O4S2 — CID 55375941
N-[4-[[4-(4-ethylpiperazin-1-yl)sulfonylphenyl]carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 55375941) has the molecular formula C24H26N4O4S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is N-[4-[[4-(4-ethylpiperazin-1-yl)sulfonylphenyl]carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[[4-(4-ethylpiperazin-1-yl)sulfonylphenyl]carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55375941 |
| Molecular Formula | C24H26N4O4S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | N-[4-[[4-(4-ethylpiperazin-1-yl)sulfonylphenyl]carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | CCN1CCN(S(=O)(=O)c2ccc(NC(=O)c3ccc(NC(=O)c4cccs4)cc3)cc2)CC1 |
| InChI | InChI=1S/C24H26N4O4S2/c1-2-27-13-15-28(16-14-27)34(31,32)21-11-9-20(10-12-21)25-23(29)18-5-7-19(8-6-18)26-24(30)22-4-3-17-33-22/h3-12,17H,2,13-16H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | BCGOLTWZNYHAMW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |