C22H21N3O4S2 — CID 17440704
N-[4-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 17440704) has the molecular formula C22H21N3O4S2 and a molecular weight of 455.56 g/mol. Its IUPAC name is N-[4-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17440704 |
| Molecular Formula | C22H21N3O4S2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | N-[4-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCCC2)cc1)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C22H21N3O4S2/c26-21(16-5-7-17(8-6-16)24-22(27)20-4-3-15-30-20)23-18-9-11-19(12-10-18)31(28,29)25-13-1-2-14-25/h3-12,15H,1-2,13-14H2,(H,23,26)(H,24,27) |
| InChIKey | CNHCZVKTSKNWOS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |