C22H23N3O5S2 — CID 55630348
[4-(thiophene-2-carbonylamino)phenyl] 1-methyl-4-piperidin-1-ylsulfonylpyrrole-2-carboxylate (PubChem CID 55630348) has the molecular formula C22H23N3O5S2 and a molecular weight of 473.58 g/mol. Its IUPAC name is [4-(thiophene-2-carbonylamino)phenyl] 1-methyl-4-piperidin-1-ylsulfonylpyrrole-2-carboxylate.
| Compound Name | [4-(thiophene-2-carbonylamino)phenyl] 1-methyl-4-piperidin-1-ylsulfonylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 55630348 |
| Molecular Formula | C22H23N3O5S2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | [4-(thiophene-2-carbonylamino)phenyl] 1-methyl-4-piperidin-1-ylsulfonylpyrrole-2-carboxylate |
| SMILES | Cn1cc(S(=O)(=O)N2CCCCC2)cc1C(=O)Oc1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C22H23N3O5S2/c1-24-15-18(32(28,29)25-11-3-2-4-12-25)14-19(24)22(27)30-17-9-7-16(8-10-17)23-21(26)20-6-5-13-31-20/h5-10,13-15H,2-4,11-12H2,1H3,(H,23,26) |
| InChIKey | YIYMTUFLANNELO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|