C20H27N3O3S — CID 27873802
N-(4-tert-butylphenyl)-1-methyl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide (PubChem CID 27873802) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-1-methyl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-1-methyl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 27873802 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | N-(4-tert-butylphenyl)-1-methyl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)N2CCCC2)cc1C(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H27N3O3S/c1-20(2,3)15-7-9-16(10-8-15)21-19(24)18-13-17(14-22(18)4)27(25,26)23-11-5-6-12-23/h7-10,13-14H,5-6,11-12H2,1-4H3,(H,21,24) |
| InChIKey | CVJQCYSPWXQMDK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |