C18H27N5O3S — CID 86860488
N-(1-tert-butylpyrazol-4-yl)-1-methyl-4-piperidin-1-ylsulfonylpyrrole-2-carboxamide (PubChem CID 86860488) has the molecular formula C18H27N5O3S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-(1-tert-butylpyrazol-4-yl)-1-methyl-4-piperidin-1-ylsulfonylpyrrole-2-carboxamide.
| Compound Name | N-(1-tert-butylpyrazol-4-yl)-1-methyl-4-piperidin-1-ylsulfonylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 86860488 |
| Molecular Formula | C18H27N5O3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | N-(1-tert-butylpyrazol-4-yl)-1-methyl-4-piperidin-1-ylsulfonylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)N2CCCCC2)cc1C(=O)Nc1cnn(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H27N5O3S/c1-18(2,3)23-12-14(11-19-23)20-17(24)16-10-15(13-21(16)4)27(25,26)22-8-6-5-7-9-22/h10-13H,5-9H2,1-4H3,(H,20,24) |
| InChIKey | QXLUFESTDLNSNX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |