C21H29N5O3S — CID 27896718
1-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide (PubChem CID 27896718) has the molecular formula C21H29N5O3S and a molecular weight of 431.56 g/mol. Its IUPAC name is 1-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide.
| Compound Name | 1-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 27896718 |
| Molecular Formula | C21H29N5O3S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 1-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3cc(S(=O)(=O)N4CCCC4)cn3C)cc2)CC1 |
| InChI | InChI=1S/C21H29N5O3S/c1-23-11-13-25(14-12-23)18-7-5-17(6-8-18)22-21(27)20-15-19(16-24(20)2)30(28,29)26-9-3-4-10-26/h5-8,15-16H,3-4,9-14H2,1-2H3,(H,22,27) |
| InChIKey | AURYZGWWJZFTGO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 77.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|