C17H21N3O4S2 — CID 17407087
1-methyl-N-(4-methylsulfanylphenyl)-4-morpholin-4-ylsulfonylpyrrole-2-carboxamide (PubChem CID 17407087) has the molecular formula C17H21N3O4S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 1-methyl-N-(4-methylsulfanylphenyl)-4-morpholin-4-ylsulfonylpyrrole-2-carboxamide.
| Compound Name | 1-methyl-N-(4-methylsulfanylphenyl)-4-morpholin-4-ylsulfonylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 17407087 |
| Molecular Formula | C17H21N3O4S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 1-methyl-N-(4-methylsulfanylphenyl)-4-morpholin-4-ylsulfonylpyrrole-2-carboxamide |
| SMILES | CSc1ccc(NC(=O)c2cc(S(=O)(=O)N3CCOCC3)cn2C)cc1 |
| InChI | InChI=1S/C17H21N3O4S2/c1-19-12-15(26(22,23)20-7-9-24-10-8-20)11-16(19)17(21)18-13-3-5-14(25-2)6-4-13/h3-6,11-12H,7-10H2,1-2H3,(H,18,21) |
| InChIKey | ZPDPKXILEKACRP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |