C20H28N4O6S2 — CID 24532844
N-[3-(butylsulfamoyl)phenyl]-1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxamide (PubChem CID 24532844) has the molecular formula C20H28N4O6S2 and a molecular weight of 484.60 g/mol. Its IUPAC name is N-[3-(butylsulfamoyl)phenyl]-1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxamide.
| Compound Name | N-[3-(butylsulfamoyl)phenyl]-1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 24532844 |
| Molecular Formula | C20H28N4O6S2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | N-[3-(butylsulfamoyl)phenyl]-1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carboxamide |
| SMILES | CCCCNS(=O)(=O)c1cccc(NC(=O)c2cc(S(=O)(=O)N3CCOCC3)cn2C)c1 |
| InChI | InChI=1S/C20H28N4O6S2/c1-3-4-8-21-31(26,27)17-7-5-6-16(13-17)22-20(25)19-14-18(15-23(19)2)32(28,29)24-9-11-30-12-10-24/h5-7,13-15,21H,3-4,8-12H2,1-2H3,(H,22,25) |
| InChIKey | BORRVABXPALFBC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|