C21H21N3O5S2 — CID 31842656
[4-(thiophene-2-carbonylamino)phenyl] 1-methyl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxylate (PubChem CID 31842656) has the molecular formula C21H21N3O5S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is [4-(thiophene-2-carbonylamino)phenyl] 1-methyl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxylate.
| Compound Name | [4-(thiophene-2-carbonylamino)phenyl] 1-methyl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 31842656 |
| Molecular Formula | C21H21N3O5S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | [4-(thiophene-2-carbonylamino)phenyl] 1-methyl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxylate |
| SMILES | Cn1cc(S(=O)(=O)N2CCCC2)cc1C(=O)Oc1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C21H21N3O5S2/c1-23-14-17(31(27,28)24-10-2-3-11-24)13-18(23)21(26)29-16-8-6-15(7-9-16)22-20(25)19-5-4-12-30-19/h4-9,12-14H,2-3,10-11H2,1H3,(H,22,25) |
| InChIKey | WPAVBTHWVZXSIP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|