C18H15BrN4O3S — CID 27037249
N-[4-[[(4-bromo-1-methylpyrrole-2-carbonyl)amino]carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 27037249) has the molecular formula C18H15BrN4O3S and a molecular weight of 447.31 g/mol. Its IUPAC name is N-[4-[[(4-bromo-1-methylpyrrole-2-carbonyl)amino]carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[[(4-bromo-1-methylpyrrole-2-carbonyl)amino]carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 27037249 |
| Molecular Formula | C18H15BrN4O3S |
| Molecular Weight | 447.31 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | N-[4-[[(4-bromo-1-methylpyrrole-2-carbonyl)amino]carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | Cn1cc(Br)cc1C(=O)NNC(=O)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H15BrN4O3S/c1-23-10-12(19)9-14(23)17(25)22-21-16(24)11-4-6-13(7-5-11)20-18(26)15-3-2-8-27-15/h2-10H,1H3,(H,20,26)(H,21,24)(H,22,25) |
| InChIKey | DYCMKIHBYNAYBG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|