C17H19BrN4O3S — CID 18228534
N'-(4-bromo-1-methylpyrrole-2-carbonyl)-1-(thiophene-2-carbonyl)piperidine-4-carbohydrazide (PubChem CID 18228534) has the molecular formula C17H19BrN4O3S and a molecular weight of 439.34 g/mol. Its IUPAC name is N'-(4-bromo-1-methylpyrrole-2-carbonyl)-1-(thiophene-2-carbonyl)piperidine-4-carbohydrazide.
| Compound Name | N'-(4-bromo-1-methylpyrrole-2-carbonyl)-1-(thiophene-2-carbonyl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 18228534 |
| Molecular Formula | C17H19BrN4O3S |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | N'-(4-bromo-1-methylpyrrole-2-carbonyl)-1-(thiophene-2-carbonyl)piperidine-4-carbohydrazide |
| SMILES | Cn1cc(Br)cc1C(=O)NNC(=O)C1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C17H19BrN4O3S/c1-21-10-12(18)9-13(21)16(24)20-19-15(23)11-4-6-22(7-5-11)17(25)14-3-2-8-26-14/h2-3,8-11H,4-7H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | GGMDWBDYPCZNOQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|