C12H12BrN3O2S — CID 27021573
4-bromo-1-methyl-N'-(2-thiophen-2-ylacetyl)pyrrole-2-carbohydrazide (PubChem CID 27021573) has the molecular formula C12H12BrN3O2S and a molecular weight of 342.22 g/mol. Its IUPAC name is 4-bromo-1-methyl-N'-(2-thiophen-2-ylacetyl)pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-1-methyl-N'-(2-thiophen-2-ylacetyl)pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 27021573 |
| Molecular Formula | C12H12BrN3O2S |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 4-bromo-1-methyl-N'-(2-thiophen-2-ylacetyl)pyrrole-2-carbohydrazide |
| SMILES | Cn1cc(Br)cc1C(=O)NNC(=O)Cc1cccs1 |
| InChI | InChI=1S/C12H12BrN3O2S/c1-16-7-8(13)5-10(16)12(18)15-14-11(17)6-9-3-2-4-19-9/h2-5,7H,6H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | IRMRGOAQBWKQEG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|