C17H20BrN3O5 — CID 24533026
4-bromo-1-methyl-N'-[2-(2,3,4-trimethoxyphenyl)acetyl]pyrrole-2-carbohydrazide (PubChem CID 24533026) has the molecular formula C17H20BrN3O5 and a molecular weight of 426.27 g/mol. Its IUPAC name is 4-bromo-1-methyl-N'-[2-(2,3,4-trimethoxyphenyl)acetyl]pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-1-methyl-N'-[2-(2,3,4-trimethoxyphenyl)acetyl]pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 24533026 |
| Molecular Formula | C17H20BrN3O5 |
| Molecular Weight | 426.27 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 4-bromo-1-methyl-N'-[2-(2,3,4-trimethoxyphenyl)acetyl]pyrrole-2-carbohydrazide |
| SMILES | COc1ccc(CC(=O)NNC(=O)c2cc(Br)cn2C)c(OC)c1OC |
| InChI | InChI=1S/C17H20BrN3O5/c1-21-9-11(18)8-12(21)17(23)20-19-14(22)7-10-5-6-13(24-2)16(26-4)15(10)25-3/h5-6,8-9H,7H2,1-4H3,(H,19,22)(H,20,23) |
| InChIKey | UFCGARHYWLFJJX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|