C15H14BrF2N3O4 — CID 24532975
4-bromo-N'-[4-(difluoromethoxy)-3-methoxybenzoyl]-1-methylpyrrole-2-carbohydrazide (PubChem CID 24532975) has the molecular formula C15H14BrF2N3O4 and a molecular weight of 418.19 g/mol. Its IUPAC name is 4-bromo-N'-[4-(difluoromethoxy)-3-methoxybenzoyl]-1-methylpyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-[4-(difluoromethoxy)-3-methoxybenzoyl]-1-methylpyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 24532975 |
| Molecular Formula | C15H14BrF2N3O4 |
| Molecular Weight | 418.19 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | 4-bromo-N'-[4-(difluoromethoxy)-3-methoxybenzoyl]-1-methylpyrrole-2-carbohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2cc(Br)cn2C)ccc1OC(F)F |
| InChI | InChI=1S/C15H14BrF2N3O4/c1-21-7-9(16)6-10(21)14(23)20-19-13(22)8-3-4-11(25-15(17)18)12(5-8)24-2/h3-7,15H,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | KCRSJDVQJZIDJR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|