C15H13F2N3O4 — CID 9332711
N'-[4-(difluoromethoxy)-3-methoxybenzoyl]pyridine-2-carbohydrazide (PubChem CID 9332711) has the molecular formula C15H13F2N3O4 and a molecular weight of 337.28 g/mol. Its IUPAC name is N'-[4-(difluoromethoxy)-3-methoxybenzoyl]pyridine-2-carbohydrazide.
| Compound Name | N'-[4-(difluoromethoxy)-3-methoxybenzoyl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 9332711 |
| Molecular Formula | C15H13F2N3O4 |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N'-[4-(difluoromethoxy)-3-methoxybenzoyl]pyridine-2-carbohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2ccccn2)ccc1OC(F)F |
| InChI | InChI=1S/C15H13F2N3O4/c1-23-12-8-9(5-6-11(12)24-15(16)17)13(21)19-20-14(22)10-4-2-3-7-18-10/h2-8,15H,1H3,(H,19,21)(H,20,22) |
| InChIKey | UUQMCWXTNJDIKX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|