C14H19F2N3O3S — CID 9425633
1-tert-butyl-3-[[4-(difluoromethoxy)-3-methoxybenzoyl]amino]thiourea (PubChem CID 9425633) has the molecular formula C14H19F2N3O3S and a molecular weight of 347.39 g/mol. Its IUPAC name is 1-tert-butyl-3-[[4-(difluoromethoxy)-3-methoxybenzoyl]amino]thiourea.
| Compound Name | 1-tert-butyl-3-[[4-(difluoromethoxy)-3-methoxybenzoyl]amino]thiourea |
|---|---|
| PubChem CID | 9425633 |
| Molecular Formula | C14H19F2N3O3S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 1-tert-butyl-3-[[4-(difluoromethoxy)-3-methoxybenzoyl]amino]thiourea |
| SMILES | COc1cc(C(=O)NNC(=S)NC(C)(C)C)ccc1OC(F)F |
| InChI | InChI=1S/C14H19F2N3O3S/c1-14(2,3)17-13(23)19-18-11(20)8-5-6-9(22-12(15)16)10(7-8)21-4/h5-7,12H,1-4H3,(H,18,20)(H2,17,19,23) |
| InChIKey | VPHPQMVKTJBJSZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|