C15H21F2N3O4S — CID 9477836
1-[[4-(difluoromethoxy)-3-ethoxybenzoyl]amino]-3-[(2S)-1-methoxypropan-2-yl]thiourea (PubChem CID 9477836) has the molecular formula C15H21F2N3O4S and a molecular weight of 377.41 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)-3-ethoxybenzoyl]amino]-3-[(2S)-1-methoxypropan-2-yl]thiourea.
| Compound Name | 1-[[4-(difluoromethoxy)-3-ethoxybenzoyl]amino]-3-[(2S)-1-methoxypropan-2-yl]thiourea |
|---|---|
| PubChem CID | 9477836 |
| Molecular Formula | C15H21F2N3O4S |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 1-[[4-(difluoromethoxy)-3-ethoxybenzoyl]amino]-3-[(2S)-1-methoxypropan-2-yl]thiourea |
| SMILES | CCOc1cc(C(=O)NNC(=S)N[C@@H](C)COC)ccc1OC(F)F |
| InChI | InChI=1S/C15H21F2N3O4S/c1-4-23-12-7-10(5-6-11(12)24-14(16)17)13(21)19-20-15(25)18-9(2)8-22-3/h5-7,9,14H,4,8H2,1-3H3,(H,19,21)(H2,18,20,25)/t9-/m0/s1 |
| InChIKey | APPGSYXKNAACCW-VIFPVBQESA-N |
| XLogP | 1.83 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|