C21H25F2N3O4 — CID 9156060
N'-[4-(diethylamino)benzoyl]-4-(difluoromethoxy)-3-ethoxybenzohydrazide (PubChem CID 9156060) has the molecular formula C21H25F2N3O4 and a molecular weight of 421.44 g/mol. Its IUPAC name is N'-[4-(diethylamino)benzoyl]-4-(difluoromethoxy)-3-ethoxybenzohydrazide.
| Compound Name | N'-[4-(diethylamino)benzoyl]-4-(difluoromethoxy)-3-ethoxybenzohydrazide |
|---|---|
| PubChem CID | 9156060 |
| Molecular Formula | C21H25F2N3O4 |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N'-[4-(diethylamino)benzoyl]-4-(difluoromethoxy)-3-ethoxybenzohydrazide |
| SMILES | CCOc1cc(C(=O)NNC(=O)c2ccc(N(CC)CC)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C21H25F2N3O4/c1-4-26(5-2)16-10-7-14(8-11-16)19(27)24-25-20(28)15-9-12-17(30-21(22)23)18(13-15)29-6-3/h7-13,21H,4-6H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | YZBAMGLEQIWTBD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|