C15H20F2N2O4 — CID 8752340
4-(difluoromethoxy)-3-ethoxy-N-[(2R)-1-(ethylamino)-1-oxopropan-2-yl]benzamide (PubChem CID 8752340) has the molecular formula C15H20F2N2O4 and a molecular weight of 330.33 g/mol. Its IUPAC name is 4-(difluoromethoxy)-3-ethoxy-N-[(2R)-1-(ethylamino)-1-oxopropan-2-yl]benzamide.
| Compound Name | 4-(difluoromethoxy)-3-ethoxy-N-[(2R)-1-(ethylamino)-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 8752340 |
| Molecular Formula | C15H20F2N2O4 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 4-(difluoromethoxy)-3-ethoxy-N-[(2R)-1-(ethylamino)-1-oxopropan-2-yl]benzamide |
| SMILES | CCNC(=O)[C@@H](C)NC(=O)c1ccc(OC(F)F)c(OCC)c1 |
| InChI | InChI=1S/C15H20F2N2O4/c1-4-18-13(20)9(3)19-14(21)10-6-7-11(23-15(16)17)12(8-10)22-5-2/h6-9,15H,4-5H2,1-3H3,(H,18,20)(H,19,21)/t9-/m1/s1 |
| InChIKey | BNBFVUJBLPVCGF-SECBINFHSA-N |
| XLogP | 1.94 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |