C18H17ClF2N2O5 — CID 9470195
N'-[2-(2-chlorophenoxy)acetyl]-4-(difluoromethoxy)-3-ethoxybenzohydrazide (PubChem CID 9470195) has the molecular formula C18H17ClF2N2O5 and a molecular weight of 414.79 g/mol. Its IUPAC name is N'-[2-(2-chlorophenoxy)acetyl]-4-(difluoromethoxy)-3-ethoxybenzohydrazide.
| Compound Name | N'-[2-(2-chlorophenoxy)acetyl]-4-(difluoromethoxy)-3-ethoxybenzohydrazide |
|---|---|
| PubChem CID | 9470195 |
| Molecular Formula | C18H17ClF2N2O5 |
| Molecular Weight | 414.79 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | N'-[2-(2-chlorophenoxy)acetyl]-4-(difluoromethoxy)-3-ethoxybenzohydrazide |
| SMILES | CCOc1cc(C(=O)NNC(=O)COc2ccccc2Cl)ccc1OC(F)F |
| InChI | InChI=1S/C18H17ClF2N2O5/c1-2-26-15-9-11(7-8-14(15)28-18(20)21)17(25)23-22-16(24)10-27-13-6-4-3-5-12(13)19/h3-9,18H,2,10H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | ZHVBIRUACKDGFP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.79 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|