C22H28F2N2O3 — CID 24649811
N-[2-(diethylamino)-2-phenylethyl]-4-(difluoromethoxy)-3-ethoxybenzamide (PubChem CID 24649811) has the molecular formula C22H28F2N2O3 and a molecular weight of 406.47 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-phenylethyl]-4-(difluoromethoxy)-3-ethoxybenzamide.
| Compound Name | N-[2-(diethylamino)-2-phenylethyl]-4-(difluoromethoxy)-3-ethoxybenzamide |
|---|---|
| PubChem CID | 24649811 |
| Molecular Formula | C22H28F2N2O3 |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | N-[2-(diethylamino)-2-phenylethyl]-4-(difluoromethoxy)-3-ethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NCC(c2ccccc2)N(CC)CC)ccc1OC(F)F |
| InChI | InChI=1S/C22H28F2N2O3/c1-4-26(5-2)18(16-10-8-7-9-11-16)15-25-21(27)17-12-13-19(29-22(23)24)20(14-17)28-6-3/h7-14,18,22H,4-6,15H2,1-3H3,(H,25,27) |
| InChIKey | UYKLFNAAYFUAFD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |