C11H15ClN4O2S — CID 9478408
1-[(6-chloropyridine-3-carbonyl)amino]-3-[(2R)-1-methoxypropan-2-yl]thiourea (PubChem CID 9478408) has the molecular formula C11H15ClN4O2S and a molecular weight of 302.79 g/mol. Its IUPAC name is 1-[(6-chloropyridine-3-carbonyl)amino]-3-[(2R)-1-methoxypropan-2-yl]thiourea.
| Compound Name | 1-[(6-chloropyridine-3-carbonyl)amino]-3-[(2R)-1-methoxypropan-2-yl]thiourea |
|---|---|
| PubChem CID | 9478408 |
| Molecular Formula | C11H15ClN4O2S |
| Molecular Weight | 302.79 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 1-[(6-chloropyridine-3-carbonyl)amino]-3-[(2R)-1-methoxypropan-2-yl]thiourea |
| SMILES | COC[C@@H](C)NC(=S)NNC(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C11H15ClN4O2S/c1-7(6-18-2)14-11(19)16-15-10(17)8-3-4-9(12)13-5-8/h3-5,7H,6H2,1-2H3,(H,15,17)(H2,14,16,19)/t7-/m1/s1 |
| InChIKey | XIRCYCMOZHZEQB-SSDOTTSWSA-N |
| XLogP | 0.88 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.79 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|