C13H17F2N3O3S — CID 7978091
1-[[4-(difluoromethoxy)-3-methoxybenzoyl]amino]-3-propan-2-ylthiourea (PubChem CID 7978091) has the molecular formula C13H17F2N3O3S and a molecular weight of 333.36 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)-3-methoxybenzoyl]amino]-3-propan-2-ylthiourea.
| Compound Name | 1-[[4-(difluoromethoxy)-3-methoxybenzoyl]amino]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 7978091 |
| Molecular Formula | C13H17F2N3O3S |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 1-[[4-(difluoromethoxy)-3-methoxybenzoyl]amino]-3-propan-2-ylthiourea |
| SMILES | COc1cc(C(=O)NNC(=S)NC(C)C)ccc1OC(F)F |
| InChI | InChI=1S/C13H17F2N3O3S/c1-7(2)16-13(22)18-17-11(19)8-4-5-9(21-12(14)15)10(6-8)20-3/h4-7,12H,1-3H3,(H,17,19)(H2,16,18,22) |
| InChIKey | NVFFGJVYLBZGCY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|