C16H22F2N4O5S — CID 9477571
4-(difluoromethoxy)-3-methoxy-N-[2-[2-[[(2S)-1-methoxypropan-2-yl]carbamothioyl]hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 9477571) has the molecular formula C16H22F2N4O5S and a molecular weight of 420.44 g/mol. Its IUPAC name is 4-(difluoromethoxy)-3-methoxy-N-[2-[2-[[(2S)-1-methoxypropan-2-yl]carbamothioyl]hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 4-(difluoromethoxy)-3-methoxy-N-[2-[2-[[(2S)-1-methoxypropan-2-yl]carbamothioyl]hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 9477571 |
| Molecular Formula | C16H22F2N4O5S |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 4-(difluoromethoxy)-3-methoxy-N-[2-[2-[[(2S)-1-methoxypropan-2-yl]carbamothioyl]hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | COC[C@H](C)NC(=S)NNC(=O)CNC(=O)c1ccc(OC(F)F)c(OC)c1 |
| InChI | InChI=1S/C16H22F2N4O5S/c1-9(8-25-2)20-16(28)22-21-13(23)7-19-14(24)10-4-5-11(27-15(17)18)12(6-10)26-3/h4-6,9,15H,7-8H2,1-3H3,(H,19,24)(H,21,23)(H2,20,22,28)/t9-/m0/s1 |
| InChIKey | PBCBJPLYVPIHBU-VIFPVBQESA-N |
| XLogP | 0.56 |
| TPSA | 109.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|