C17H14BrF4N3O4 — CID 27037215
N'-[(E)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]-4-bromo-1-methylpyrrole-2-carbohydrazide (PubChem CID 27037215) has the molecular formula C17H14BrF4N3O4 and a molecular weight of 480.21 g/mol. Its IUPAC name is N'-[(E)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]-4-bromo-1-methylpyrrole-2-carbohydrazide.
| Compound Name | N'-[(E)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]-4-bromo-1-methylpyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 27037215 |
| Molecular Formula | C17H14BrF4N3O4 |
| Molecular Weight | 480.21 g/mol |
| Exact Mass | 479.01 |
| IUPAC Name | N'-[(E)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]-4-bromo-1-methylpyrrole-2-carbohydrazide |
| SMILES | Cn1cc(Br)cc1C(=O)NNC(=O)/C=C/c1ccc(OC(F)F)cc1OC(F)F |
| InChI | InChI=1S/C17H14BrF4N3O4/c1-25-8-10(18)6-12(25)15(27)24-23-14(26)5-3-9-2-4-11(28-16(19)20)7-13(9)29-17(21)22/h2-8,16-17H,1H3,(H,23,26)(H,24,27)/b5-3+ |
| InChIKey | HLFQRFVYWZKWTA-HWKANZROSA-N |
| XLogP | 3.46 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.21 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|