C12H14BrN3O2 — CID 27036806
4-bromo-N'-[(2E,4E)-hexa-2,4-dienoyl]-1-methylpyrrole-2-carbohydrazide (PubChem CID 27036806) has the molecular formula C12H14BrN3O2 and a molecular weight of 312.17 g/mol. Its IUPAC name is 4-bromo-N'-[(2E,4E)-hexa-2,4-dienoyl]-1-methylpyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-[(2E,4E)-hexa-2,4-dienoyl]-1-methylpyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 27036806 |
| Molecular Formula | C12H14BrN3O2 |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 4-bromo-N'-[(2E,4E)-hexa-2,4-dienoyl]-1-methylpyrrole-2-carbohydrazide |
| SMILES | C/C=C/C=C/C(=O)NNC(=O)c1cc(Br)cn1C |
| InChI | InChI=1S/C12H14BrN3O2/c1-3-4-5-6-11(17)14-15-12(18)10-7-9(13)8-16(10)2/h3-8H,1-2H3,(H,14,17)(H,15,18)/b4-3+,6-5+ |
| InChIKey | ZPHDLOOVTSXAER-VNKDHWASSA-N |
| XLogP | 1.68 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|