C13H13BrN2O2 — CID 7964442
4-bromo-N'-[(2E,4E)-hexa-2,4-dienoyl]benzohydrazide (PubChem CID 7964442) has the molecular formula C13H13BrN2O2 and a molecular weight of 309.16 g/mol. Its IUPAC name is 4-bromo-N'-[(2E,4E)-hexa-2,4-dienoyl]benzohydrazide.
| Compound Name | 4-bromo-N'-[(2E,4E)-hexa-2,4-dienoyl]benzohydrazide |
|---|---|
| PubChem CID | 7964442 |
| Molecular Formula | C13H13BrN2O2 |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 4-bromo-N'-[(2E,4E)-hexa-2,4-dienoyl]benzohydrazide |
| SMILES | C/C=C/C=C/C(=O)NNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H13BrN2O2/c1-2-3-4-5-12(17)15-16-13(18)10-6-8-11(14)9-7-10/h2-9H,1H3,(H,15,17)(H,16,18)/b3-2+,5-4+ |
| InChIKey | MZKPQDYOBVQWPJ-MQQKCMAXSA-N |
| XLogP | 2.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|