C20H22BrN3O2 — CID 9155917
N'-[(E)-3-(4-bromophenyl)prop-2-enoyl]-4-(diethylamino)benzohydrazide (PubChem CID 9155917) has the molecular formula C20H22BrN3O2 and a molecular weight of 416.32 g/mol. Its IUPAC name is N'-[(E)-3-(4-bromophenyl)prop-2-enoyl]-4-(diethylamino)benzohydrazide.
| Compound Name | N'-[(E)-3-(4-bromophenyl)prop-2-enoyl]-4-(diethylamino)benzohydrazide |
|---|---|
| PubChem CID | 9155917 |
| Molecular Formula | C20H22BrN3O2 |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N'-[(E)-3-(4-bromophenyl)prop-2-enoyl]-4-(diethylamino)benzohydrazide |
| SMILES | CCN(CC)c1ccc(C(=O)NNC(=O)/C=C/c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C20H22BrN3O2/c1-3-24(4-2)18-12-8-16(9-13-18)20(26)23-22-19(25)14-7-15-5-10-17(21)11-6-15/h5-14H,3-4H2,1-2H3,(H,22,25)(H,23,26)/b14-7+ |
| InChIKey | WZYKXUIZEUZOIK-VGOFMYFVSA-N |
| XLogP | 3.77 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|