C21H25N3O2 — CID 9156146
4-(diethylamino)-N'-[(E)-3-(2-methylphenyl)prop-2-enoyl]benzohydrazide (PubChem CID 9156146) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-(diethylamino)-N'-[(E)-3-(2-methylphenyl)prop-2-enoyl]benzohydrazide.
| Compound Name | 4-(diethylamino)-N'-[(E)-3-(2-methylphenyl)prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 9156146 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 4-(diethylamino)-N'-[(E)-3-(2-methylphenyl)prop-2-enoyl]benzohydrazide |
| SMILES | CCN(CC)c1ccc(C(=O)NNC(=O)/C=C/c2ccccc2C)cc1 |
| InChI | InChI=1S/C21H25N3O2/c1-4-24(5-2)19-13-10-18(11-14-19)21(26)23-22-20(25)15-12-17-9-7-6-8-16(17)3/h6-15H,4-5H2,1-3H3,(H,22,25)(H,23,26)/b15-12+ |
| InChIKey | VTPUQEFOLCAGSA-NTCAYCPXSA-N |
| XLogP | 3.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|