C17H17N3OS — CID 24644060
1-[[(E)-3-(2-methylphenyl)prop-2-enoyl]amino]-3-phenylthiourea (PubChem CID 24644060) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 1-[[(E)-3-(2-methylphenyl)prop-2-enoyl]amino]-3-phenylthiourea.
| Compound Name | 1-[[(E)-3-(2-methylphenyl)prop-2-enoyl]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 24644060 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1-[[(E)-3-(2-methylphenyl)prop-2-enoyl]amino]-3-phenylthiourea |
| SMILES | Cc1ccccc1/C=C/C(=O)NNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C17H17N3OS/c1-13-7-5-6-8-14(13)11-12-16(21)19-20-17(22)18-15-9-3-2-4-10-15/h2-12H,1H3,(H,19,21)(H2,18,20,22)/b12-11+ |
| InChIKey | MPEDRUUFUKHGFL-VAWYXSNFSA-N |
| XLogP | 3.03 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|