C16H18N4S2 — CID 8001043
1-(3,5-dimethylphenyl)-3-(phenylcarbamothioylamino)thiourea (PubChem CID 8001043) has the molecular formula C16H18N4S2 and a molecular weight of 330.48 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-(phenylcarbamothioylamino)thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-(phenylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 8001043 |
| Molecular Formula | C16H18N4S2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-(phenylcarbamothioylamino)thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)NNC(=S)Nc2ccccc2)c1 |
| InChI | InChI=1S/C16H18N4S2/c1-11-8-12(2)10-14(9-11)18-16(22)20-19-15(21)17-13-6-4-3-5-7-13/h3-10H,1-2H3,(H2,17,19,21)(H2,18,20,22) |
| InChIKey | BYLVBHCCEUTELS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|