C17H20N6OS2 — CID 2823948
1,3-bis[(3-methylphenyl)carbamothioylamino]urea (PubChem CID 2823948) has the molecular formula C17H20N6OS2 and a molecular weight of 388.52 g/mol. Its IUPAC name is 1,3-bis[(3-methylphenyl)carbamothioylamino]urea.
| Compound Name | 1,3-bis[(3-methylphenyl)carbamothioylamino]urea |
|---|---|
| PubChem CID | 2823948 |
| Molecular Formula | C17H20N6OS2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 1,3-bis[(3-methylphenyl)carbamothioylamino]urea |
| SMILES | Cc1cccc(NC(=S)NNC(=O)NNC(=S)Nc2cccc(C)c2)c1 |
| InChI | InChI=1S/C17H20N6OS2/c1-11-5-3-7-13(9-11)18-16(25)22-20-15(24)21-23-17(26)19-14-8-4-6-12(2)10-14/h3-10H,1-2H3,(H2,18,22,25)(H2,19,23,26)(H2,20,21,24) |
| InChIKey | RBXYAAPAJGRYKV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|