C24H26N2OS — CID 43077075
1-(3,5-dimethylphenyl)-3-[[4-(phenylmethoxymethyl)phenyl]methyl]thiourea (PubChem CID 43077075) has the molecular formula C24H26N2OS and a molecular weight of 390.55 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[[4-(phenylmethoxymethyl)phenyl]methyl]thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[[4-(phenylmethoxymethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 43077075 |
| Molecular Formula | C24H26N2OS |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[[4-(phenylmethoxymethyl)phenyl]methyl]thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)NCc2ccc(COCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C24H26N2OS/c1-18-12-19(2)14-23(13-18)26-24(28)25-15-20-8-10-22(11-9-20)17-27-16-21-6-4-3-5-7-21/h3-14H,15-17H2,1-2H3,(H2,25,26,28) |
| InChIKey | MTGMWNONNYFNNQ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|