C14H12F2N2OS — CID 87654545
1-benzyl-3-(3,5-difluoro-4-hydroxyphenyl)thiourea (PubChem CID 87654545) has the molecular formula C14H12F2N2OS and a molecular weight of 294.33 g/mol. Its IUPAC name is 1-benzyl-3-(3,5-difluoro-4-hydroxyphenyl)thiourea.
| Compound Name | 1-benzyl-3-(3,5-difluoro-4-hydroxyphenyl)thiourea |
|---|---|
| PubChem CID | 87654545 |
| Molecular Formula | C14H12F2N2OS |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 1-benzyl-3-(3,5-difluoro-4-hydroxyphenyl)thiourea |
| SMILES | Oc1c(F)cc(NC(=S)NCc2ccccc2)cc1F |
| InChI | InChI=1S/C14H12F2N2OS/c15-11-6-10(7-12(16)13(11)19)18-14(20)17-8-9-4-2-1-3-5-9/h1-7,19H,8H2,(H2,17,18,20) |
| InChIKey | KTRCIVQVJDVOBR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|