C22H18Cl2F2N4S2 — CID 2421054
1-(4-chloro-3-fluorophenyl)-3-[[4-[[(4-chloro-3-fluorophenyl)carbamothioylamino]methyl]phenyl]methyl]thiourea (PubChem CID 2421054) has the molecular formula C22H18Cl2F2N4S2 and a molecular weight of 511.45 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-3-[[4-[[(4-chloro-3-fluorophenyl)carbamothioylamino]methyl]phenyl]methyl]thiourea.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-3-[[4-[[(4-chloro-3-fluorophenyl)carbamothioylamino]methyl]phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 2421054 |
| Molecular Formula | C22H18Cl2F2N4S2 |
| Molecular Weight | 511.45 g/mol |
| Exact Mass | 510.03 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-3-[[4-[[(4-chloro-3-fluorophenyl)carbamothioylamino]methyl]phenyl]methyl]thiourea |
| SMILES | Fc1cc(NC(=S)NCc2ccc(CNC(=S)Nc3ccc(Cl)c(F)c3)cc2)ccc1Cl |
| InChI | InChI=1S/C22H18Cl2F2N4S2/c23-17-7-5-15(9-19(17)25)29-21(31)27-11-13-1-2-14(4-3-13)12-28-22(32)30-16-6-8-18(24)20(26)10-16/h1-10H,11-12H2,(H2,27,29,31)(H2,28,30,32) |
| InChIKey | AGOYBDGDMVYPKN-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.45 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|