C16H11ClF6N2S — CID 19649262
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-chlorophenyl)methyl]thiourea (PubChem CID 19649262) has the molecular formula C16H11ClF6N2S and a molecular weight of 412.79 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-chlorophenyl)methyl]thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-chlorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 19649262 |
| Molecular Formula | C16H11ClF6N2S |
| Molecular Weight | 412.79 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-chlorophenyl)methyl]thiourea |
| SMILES | FC(F)(F)c1cc(NC(=S)NCc2ccc(Cl)cc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H11ClF6N2S/c17-12-3-1-9(2-4-12)8-24-14(26)25-13-6-10(15(18,19)20)5-11(7-13)16(21,22)23/h1-7H,8H2,(H2,24,25,26) |
| InChIKey | NGWZNVUYVXNVJH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.79 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|