C12H12F6N2OS — CID 127087910
1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-hydroxypropyl)thiourea (PubChem CID 127087910) has the molecular formula C12H12F6N2OS and a molecular weight of 346.30 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-hydroxypropyl)thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-hydroxypropyl)thiourea |
|---|---|
| PubChem CID | 127087910 |
| Molecular Formula | C12H12F6N2OS |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-hydroxypropyl)thiourea |
| SMILES | OCCCNC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F6N2OS/c13-11(14,15)7-4-8(12(16,17)18)6-9(5-7)20-10(22)19-2-1-3-21/h4-6,21H,1-3H2,(H2,19,20,22) |
| InChIKey | ZGQFOTAAVADGBW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|