C17H22F4N2OS — CID 170054217
1-[3,5-bis(1,1-difluoroethyl)phenyl]-3-(6-oxohexyl)thiourea (PubChem CID 170054217) has the molecular formula C17H22F4N2OS and a molecular weight of 378.44 g/mol. Its IUPAC name is 1-[3,5-bis(1,1-difluoroethyl)phenyl]-3-(6-oxohexyl)thiourea.
| Compound Name | 1-[3,5-bis(1,1-difluoroethyl)phenyl]-3-(6-oxohexyl)thiourea |
|---|---|
| PubChem CID | 170054217 |
| Molecular Formula | C17H22F4N2OS |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1-[3,5-bis(1,1-difluoroethyl)phenyl]-3-(6-oxohexyl)thiourea |
| SMILES | CC(F)(F)c1cc(NC(=S)NCCCCCC=O)cc(C(C)(F)F)c1 |
| InChI | InChI=1S/C17H22F4N2OS/c1-16(18,19)12-9-13(17(2,20)21)11-14(10-12)23-15(25)22-7-5-3-4-6-8-24/h8-11H,3-7H2,1-2H3,(H2,22,23,25) |
| InChIKey | ZFYIYZVSDCEOFG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|