C25H42N2S — CID 155242561
1-[(Z)-octadec-9-enyl]-3-phenylthiourea (PubChem CID 155242561) has the molecular formula C25H42N2S and a molecular weight of 402.69 g/mol. Its IUPAC name is 1-[(Z)-octadec-9-enyl]-3-phenylthiourea.
| Compound Name | 1-[(Z)-octadec-9-enyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 155242561 |
| Molecular Formula | C25H42N2S |
| Molecular Weight | 402.69 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | 1-[(Z)-octadec-9-enyl]-3-phenylthiourea |
| SMILES | CCCCCCCC/C=C\CCCCCCCCNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C25H42N2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-23-26-25(28)27-24-21-18-17-19-22-24/h9-10,17-19,21-22H,2-8,11-16,20,23H2,1H3,(H2,26,27,28)/b10-9- |
| InChIKey | GWDSCOGJEGXQDI-KTKRTIGZSA-N |
| XLogP | 8.01 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.69 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|