C21H28N4S2 — CID 3094104
1-phenyl-3-[7-(phenylcarbamothioylamino)heptyl]thiourea (PubChem CID 3094104) has the molecular formula C21H28N4S2 and a molecular weight of 400.62 g/mol. Its IUPAC name is 1-phenyl-3-[7-(phenylcarbamothioylamino)heptyl]thiourea.
| Compound Name | 1-phenyl-3-[7-(phenylcarbamothioylamino)heptyl]thiourea |
|---|---|
| PubChem CID | 3094104 |
| Molecular Formula | C21H28N4S2 |
| Molecular Weight | 400.62 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 1-phenyl-3-[7-(phenylcarbamothioylamino)heptyl]thiourea |
| SMILES | S=C(NCCCCCCCNC(=S)Nc1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C21H28N4S2/c26-20(24-18-12-6-4-7-13-18)22-16-10-2-1-3-11-17-23-21(27)25-19-14-8-5-9-15-19/h4-9,12-15H,1-3,10-11,16-17H2,(H2,22,24,26)(H2,23,25,27) |
| InChIKey | DUSHHXORBLKKIX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|