C15H22N4O2S2 — CID 8618429
methyl 6-[(phenylcarbamothioylamino)carbamothioylamino]hexanoate (PubChem CID 8618429) has the molecular formula C15H22N4O2S2 and a molecular weight of 354.50 g/mol. Its IUPAC name is methyl 6-[(phenylcarbamothioylamino)carbamothioylamino]hexanoate.
| Compound Name | methyl 6-[(phenylcarbamothioylamino)carbamothioylamino]hexanoate |
|---|---|
| PubChem CID | 8618429 |
| Molecular Formula | C15H22N4O2S2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | methyl 6-[(phenylcarbamothioylamino)carbamothioylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=S)NNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C15H22N4O2S2/c1-21-13(20)10-6-3-7-11-16-14(22)18-19-15(23)17-12-8-4-2-5-9-12/h2,4-5,8-9H,3,6-7,10-11H2,1H3,(H2,16,18,22)(H2,17,19,23) |
| InChIKey | KYWIBTORVOUDRD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|