C14H19FN2O2S — CID 8658166
methyl 6-[(2-fluorophenyl)carbamothioylamino]hexanoate (PubChem CID 8658166) has the molecular formula C14H19FN2O2S and a molecular weight of 298.38 g/mol. Its IUPAC name is methyl 6-[(2-fluorophenyl)carbamothioylamino]hexanoate.
| Compound Name | methyl 6-[(2-fluorophenyl)carbamothioylamino]hexanoate |
|---|---|
| PubChem CID | 8658166 |
| Molecular Formula | C14H19FN2O2S |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | methyl 6-[(2-fluorophenyl)carbamothioylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=S)Nc1ccccc1F |
| InChI | InChI=1S/C14H19FN2O2S/c1-19-13(18)9-3-2-6-10-16-14(20)17-12-8-5-4-7-11(12)15/h4-5,7-8H,2-3,6,9-10H2,1H3,(H2,16,17,20) |
| InChIKey | CRBBESNRYCSORW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|