C15H21ClN2O3S — CID 3381039
methyl 6-[(5-chloro-2-methoxyphenyl)carbamothioylamino]hexanoate (PubChem CID 3381039) has the molecular formula C15H21ClN2O3S and a molecular weight of 344.86 g/mol. Its IUPAC name is methyl 6-[(5-chloro-2-methoxyphenyl)carbamothioylamino]hexanoate.
| Compound Name | methyl 6-[(5-chloro-2-methoxyphenyl)carbamothioylamino]hexanoate |
|---|---|
| PubChem CID | 3381039 |
| Molecular Formula | C15H21ClN2O3S |
| Molecular Weight | 344.86 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | methyl 6-[(5-chloro-2-methoxyphenyl)carbamothioylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=S)Nc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C15H21ClN2O3S/c1-20-13-8-7-11(16)10-12(13)18-15(22)17-9-5-3-4-6-14(19)21-2/h7-8,10H,3-6,9H2,1-2H3,(H2,17,18,22) |
| InChIKey | SOXSXVYQMNYERQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.86 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|