C12H14ClFN2O2S — CID 9053459
methyl 4-[(4-chloro-2-fluorophenyl)carbamothioylamino]butanoate (PubChem CID 9053459) has the molecular formula C12H14ClFN2O2S and a molecular weight of 304.77 g/mol. Its IUPAC name is methyl 4-[(4-chloro-2-fluorophenyl)carbamothioylamino]butanoate.
| Compound Name | methyl 4-[(4-chloro-2-fluorophenyl)carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 9053459 |
| Molecular Formula | C12H14ClFN2O2S |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | methyl 4-[(4-chloro-2-fluorophenyl)carbamothioylamino]butanoate |
| SMILES | COC(=O)CCCNC(=S)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C12H14ClFN2O2S/c1-18-11(17)3-2-6-15-12(19)16-10-5-4-8(13)7-9(10)14/h4-5,7H,2-3,6H2,1H3,(H2,15,16,19) |
| InChIKey | LBUBGVQMHXDJCF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|