C13H15Cl2N3O3S — CID 9094192
methyl 4-[[(2,5-dichlorobenzoyl)amino]carbamothioylamino]butanoate (PubChem CID 9094192) has the molecular formula C13H15Cl2N3O3S and a molecular weight of 364.25 g/mol. Its IUPAC name is methyl 4-[[(2,5-dichlorobenzoyl)amino]carbamothioylamino]butanoate.
| Compound Name | methyl 4-[[(2,5-dichlorobenzoyl)amino]carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 9094192 |
| Molecular Formula | C13H15Cl2N3O3S |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | methyl 4-[[(2,5-dichlorobenzoyl)amino]carbamothioylamino]butanoate |
| SMILES | COC(=O)CCCNC(=S)NNC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H15Cl2N3O3S/c1-21-11(19)3-2-6-16-13(22)18-17-12(20)9-7-8(14)4-5-10(9)15/h4-5,7H,2-3,6H2,1H3,(H,17,20)(H2,16,18,22) |
| InChIKey | QGTSEDLCRHHXMH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|