C17H24ClN3O4S — CID 9095187
methyl 4-[[[(2R)-2-(4-chloro-2,6-dimethylphenoxy)propanoyl]amino]carbamothioylamino]butanoate (PubChem CID 9095187) has the molecular formula C17H24ClN3O4S and a molecular weight of 401.92 g/mol. Its IUPAC name is methyl 4-[[[(2R)-2-(4-chloro-2,6-dimethylphenoxy)propanoyl]amino]carbamothioylamino]butanoate.
| Compound Name | methyl 4-[[[(2R)-2-(4-chloro-2,6-dimethylphenoxy)propanoyl]amino]carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 9095187 |
| Molecular Formula | C17H24ClN3O4S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | methyl 4-[[[(2R)-2-(4-chloro-2,6-dimethylphenoxy)propanoyl]amino]carbamothioylamino]butanoate |
| SMILES | COC(=O)CCCNC(=S)NNC(=O)[C@@H](C)Oc1c(C)cc(Cl)cc1C |
| InChI | InChI=1S/C17H24ClN3O4S/c1-10-8-13(18)9-11(2)15(10)25-12(3)16(23)20-21-17(26)19-7-5-6-14(22)24-4/h8-9,12H,5-7H2,1-4H3,(H,20,23)(H2,19,21,26)/t12-/m1/s1 |
| InChIKey | TWBCGNRLONMQHN-GFCCVEGCSA-N |
| XLogP | 2.17 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|